About 3-amino-4-fluorophenol;oxolane
3-amino-4-fluorophenol;oxolane (PubChem CID 175270087) has the molecular formula C10H14FNO2
and a molecular weight of 199.23 g/mol. Its IUPAC name is 3-amino-4-fluorophenol;oxolane.
Molecular Properties
| Compound Name | 3-amino-4-fluorophenol;oxolane |
| PubChem CID | 175270087 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3-amino-4-fluorophenol;oxolane |
| SMILES | C1CCOC1.Nc1cc(O)ccc1F |
| InChI | InChI=1S/C6H6FNO.C4H8O/c7-5-2-1-4(9)3-6(5)8;1-2-4-5-3-1/h1-3,9H,8H2;1-4H2 |
| InChIKey | NUASXZNEVYYWEO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-fluorophenol;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-fluorophenol;oxolane?
The IUPAC name of 3-amino-4-fluorophenol;oxolane (CID 175270087) is 3-amino-4-fluorophenol;oxolane.
What is the SMILES notation for 3-amino-4-fluorophenol;oxolane?
The canonical SMILES for 3-amino-4-fluorophenol;oxolane is C1CCOC1.Nc1cc(O)ccc1F.
What is the InChIKey of 3-amino-4-fluorophenol;oxolane?
The InChIKey is NUASXZNEVYYWEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNO.C4H8O/c7-5-2-1-4(9)3-6(5)8;1-2-4-5-3-1/h1-3,9H,8H2;1-4H2.
What are the key properties of 3-amino-4-fluorophenol;oxolane?
3-amino-4-fluorophenol;oxolane has a molecular weight of 199.23 g/mol, XLogP of 1.91, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-fluorophenol;oxolane is sourced from PubChem (CID 175270087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).