C16H28N2O5S — CID 175270575
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl (2S)-2,6-diaminohexanoate (PubChem CID 175270575) has the molecular formula C16H28N2O5S and a molecular weight of 360.48 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl (2S)-2,6-diaminohexanoate.
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 175270575 |
| Molecular Formula | C16H28N2O5S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl (2S)-2,6-diaminohexanoate |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)OC(=O)[C@@H](N)CCCCN)C(=O)C2 |
| InChI | InChI=1S/C16H28N2O5S/c1-15(2)11-6-7-16(15,13(19)9-11)10-24(21,22)23-14(20)12(18)5-3-4-8-17/h11-12H,3-10,17-18H2,1-2H3/t11?,12-,16?/m0/s1 |
| InChIKey | WJKPZCOICHIBFR-BGMSHATGSA-N |
| XLogP | 0.71 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|