About pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride
pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride (PubChem CID 175270706) has the molecular formula C9H10Cl2N2O2
and a molecular weight of 249.10 g/mol. Its IUPAC name is pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride.
Molecular Properties
| Compound Name | pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride |
| PubChem CID | 175270706 |
| Molecular Formula | C9H10Cl2N2O2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride |
| SMILES | CC(=O)Oc1ccn2ccncc12.Cl.Cl |
| InChI | InChI=1S/C9H8N2O2.2ClH/c1-7(12)13-9-2-4-11-5-3-10-6-8(9)11;;/h2-6H,1H3;2*1H |
| InChIKey | UUPDQTUJXAUUGC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride?
The IUPAC name of pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride (CID 175270706) is pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride.
What is the SMILES notation for pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride?
The canonical SMILES for pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride is CC(=O)Oc1ccn2ccncc12.Cl.Cl.
What is the InChIKey of pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride?
The InChIKey is UUPDQTUJXAUUGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2.2ClH/c1-7(12)13-9-2-4-11-5-3-10-6-8(9)11;;/h2-6H,1H3;2*1H.
What are the key properties of pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride?
pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride has a molecular weight of 249.10 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[1,2-a]pyrazin-8-yl acetate;dihydrochloride is sourced from PubChem (CID 175270706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).