About 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol
1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol (PubChem CID 175271639) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol.
Molecular Properties
| Compound Name | 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol |
| PubChem CID | 175271639 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol |
| SMILES | C=CC1(NCC(C)O)C=CC=CC1 |
| InChI | InChI=1S/C11H17NO/c1-3-11(12-9-10(2)13)7-5-4-6-8-11/h3-7,10,12-13H,1,8-9H2,2H3 |
| InChIKey | CGBNVMRCZSEVRR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol?
The IUPAC name of 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol (CID 175271639) is 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol.
What is the SMILES notation for 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol?
The canonical SMILES for 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol is C=CC1(NCC(C)O)C=CC=CC1.
What is the InChIKey of 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol?
The InChIKey is CGBNVMRCZSEVRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-3-11(12-9-10(2)13)7-5-4-6-8-11/h3-7,10,12-13H,1,8-9H2,2H3.
What are the key properties of 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol?
1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol has a molecular weight of 179.26 g/mol, XLogP of 1.40, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-ethenylcyclohexa-2,4-dien-1-yl)amino]propan-2-ol is sourced from PubChem (CID 175271639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).