About 1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin
1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin (PubChem CID 175272166) has the molecular formula C28H24N4
and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin.
Molecular Properties
| Compound Name | 1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin |
| PubChem CID | 175272166 |
| Molecular Formula | C28H24N4 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin |
| SMILES | Cc1cc(C)cc(C23C=C4C=CC(=N4)C=C4C=CC(=N4)C=c4ccc([nH]4)=CC(=CC2)N3)c1 |
| InChI | InChI=1S/C28H24N4/c1-18-11-19(2)13-20(12-18)28-10-9-26(32-28)16-25-6-5-22(30-25)14-21-3-4-23(29-21)15-24-7-8-27(17-28)31-24/h3-9,11-17,30,32H,10H2,1-2H3 |
| InChIKey | HEMJCXLZUCCYBR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin?
The IUPAC name of 1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin (CID 175272166) is 1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin.
What is the SMILES notation for 1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin?
The canonical SMILES for 1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin is Cc1cc(C)cc(C23C=C4C=CC(=N4)C=C4C=CC(=N4)C=c4ccc([nH]4)=CC(=CC2)N3)c1.
What is the InChIKey of 1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin?
The InChIKey is HEMJCXLZUCCYBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24N4/c1-18-11-19(2)13-20(12-18)28-10-9-26(32-28)16-25-6-5-22(30-25)14-21-3-4-23(29-21)15-24-7-8-27(17-28)31-24/h3-9,11-17,30,32H,10H2,1-2H3.
What are the key properties of 1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin?
1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin has a molecular weight of 416.53 g/mol, XLogP of 3.77, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylphenyl)-21,22-dihydro-2H-porphyrin is sourced from PubChem (CID 175272166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).