About dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione
dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione (PubChem CID 175272708) has the molecular formula C6H13NO6PS3+
and a molecular weight of 322.35 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione |
| PubChem CID | 175272708 |
| Molecular Formula | C6H13NO6PS3+ |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione |
| SMILES | CCCS(=O)(=O)O.O=[P+](O)O.S=c1[nH]ccs1 |
| InChI | InChI=1S/C3H3NS2.C3H8O3S.HO3P/c5-3-4-1-2-6-3;1-2-3-7(4,5)6;1-4(2)3/h1-2H,(H,4,5);2-3H2,1H3,(H,4,5,6);(H-,1,2,3)/p+1 |
| InChIKey | MCUGFEASIXXLBW-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione?
The IUPAC name of dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione (CID 175272708) is dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione.
What is the SMILES notation for dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione?
The canonical SMILES for dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione is CCCS(=O)(=O)O.O=[P+](O)O.S=c1[nH]ccs1.
What is the InChIKey of dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione?
The InChIKey is MCUGFEASIXXLBW-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H3NS2.C3H8O3S.HO3P/c5-3-4-1-2-6-3;1-2-3-7(4,5)6;1-4(2)3/h1-2H,(H,4,5);2-3H2,1H3,(H,4,5,6);(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione?
dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione has a molecular weight of 322.35 g/mol, XLogP of 1.72, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;propane-1-sulfonic acid;3H-1,3-thiazole-2-thione is sourced from PubChem (CID 175272708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).