About 6-chloropyridazine-3-carboxylic acid;pent-4-enamide
6-chloropyridazine-3-carboxylic acid;pent-4-enamide (PubChem CID 175273848) has the molecular formula C10H12ClN3O3
and a molecular weight of 257.68 g/mol. Its IUPAC name is 6-chloropyridazine-3-carboxylic acid;pent-4-enamide.
Molecular Properties
| Compound Name | 6-chloropyridazine-3-carboxylic acid;pent-4-enamide |
| PubChem CID | 175273848 |
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 6-chloropyridazine-3-carboxylic acid;pent-4-enamide |
| SMILES | C=CCCC(N)=O.O=C(O)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C5H3ClN2O2.C5H9NO/c6-4-2-1-3(5(9)10)7-8-4;1-2-3-4-5(6)7/h1-2H,(H,9,10);2H,1,3-4H2,(H2,6,7) |
| InChIKey | JHKBUNIGWSPYHH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloropyridazine-3-carboxylic acid;pent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloropyridazine-3-carboxylic acid;pent-4-enamide?
The IUPAC name of 6-chloropyridazine-3-carboxylic acid;pent-4-enamide (CID 175273848) is 6-chloropyridazine-3-carboxylic acid;pent-4-enamide.
What is the SMILES notation for 6-chloropyridazine-3-carboxylic acid;pent-4-enamide?
The canonical SMILES for 6-chloropyridazine-3-carboxylic acid;pent-4-enamide is C=CCCC(N)=O.O=C(O)c1ccc(Cl)nn1.
What is the InChIKey of 6-chloropyridazine-3-carboxylic acid;pent-4-enamide?
The InChIKey is JHKBUNIGWSPYHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN2O2.C5H9NO/c6-4-2-1-3(5(9)10)7-8-4;1-2-3-4-5(6)7/h1-2H,(H,9,10);2H,1,3-4H2,(H2,6,7).
What are the key properties of 6-chloropyridazine-3-carboxylic acid;pent-4-enamide?
6-chloropyridazine-3-carboxylic acid;pent-4-enamide has a molecular weight of 257.68 g/mol, XLogP of 1.27, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloropyridazine-3-carboxylic acid;pent-4-enamide is sourced from PubChem (CID 175273848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).