About 2-bromo-2-nitrohexane-1,1-diol
2-bromo-2-nitrohexane-1,1-diol (PubChem CID 175273943) has the molecular formula C6H12BrNO4
and a molecular weight of 242.07 g/mol. Its IUPAC name is 2-bromo-2-nitrohexane-1,1-diol.
Molecular Properties
| Compound Name | 2-bromo-2-nitrohexane-1,1-diol |
| PubChem CID | 175273943 |
| Molecular Formula | C6H12BrNO4 |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 2-bromo-2-nitrohexane-1,1-diol |
| SMILES | CCCCC(Br)(C(O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C6H12BrNO4/c1-2-3-4-6(7,5(9)10)8(11)12/h5,9-10H,2-4H2,1H3 |
| InChIKey | MAARKFACKWMPMW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2-nitrohexane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2-nitrohexane-1,1-diol?
The IUPAC name of 2-bromo-2-nitrohexane-1,1-diol (CID 175273943) is 2-bromo-2-nitrohexane-1,1-diol.
What is the SMILES notation for 2-bromo-2-nitrohexane-1,1-diol?
The canonical SMILES for 2-bromo-2-nitrohexane-1,1-diol is CCCCC(Br)(C(O)O)[N+](=O)[O-].
What is the InChIKey of 2-bromo-2-nitrohexane-1,1-diol?
The InChIKey is MAARKFACKWMPMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12BrNO4/c1-2-3-4-6(7,5(9)10)8(11)12/h5,9-10H,2-4H2,1H3.
What are the key properties of 2-bromo-2-nitrohexane-1,1-diol?
2-bromo-2-nitrohexane-1,1-diol has a molecular weight of 242.07 g/mol, XLogP of 0.86, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2-nitrohexane-1,1-diol is sourced from PubChem (CID 175273943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).