About [2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate
[2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate (PubChem CID 175274007) has the molecular formula C8H6ClN3O2S
and a molecular weight of 243.67 g/mol. Its IUPAC name is [2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate.
Molecular Properties
| Compound Name | [2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate |
| PubChem CID | 175274007 |
| Molecular Formula | C8H6ClN3O2S |
| Molecular Weight | 243.67 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | [2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate |
| SMILES | CC(=O)Oc1sc(Cl)nc1-c1ccn[nH]1 |
| InChI | InChI=1S/C8H6ClN3O2S/c1-4(13)14-7-6(11-8(9)15-7)5-2-3-10-12-5/h2-3H,1H3,(H,10,12) |
| InChIKey | BPPYKWWSQGLYAK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.67 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate?
The IUPAC name of [2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate (CID 175274007) is [2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate.
What is the SMILES notation for [2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate?
The canonical SMILES for [2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate is CC(=O)Oc1sc(Cl)nc1-c1ccn[nH]1.
What is the InChIKey of [2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate?
The InChIKey is BPPYKWWSQGLYAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN3O2S/c1-4(13)14-7-6(11-8(9)15-7)5-2-3-10-12-5/h2-3H,1H3,(H,10,12).
What are the key properties of [2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate?
[2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate has a molecular weight of 243.67 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-4-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl] acetate is sourced from PubChem (CID 175274007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).