About 6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid
6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 175274217) has the molecular formula C10H16O3S
and a molecular weight of 216.30 g/mol. Its IUPAC name is 6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid.
Molecular Properties
| Compound Name | 6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid |
| PubChem CID | 175274217 |
| Molecular Formula | C10H16O3S |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CCC1(C)C=CC=C(C)C1S(=O)(=O)O |
| InChI | InChI=1S/C10H16O3S/c1-4-10(3)7-5-6-8(2)9(10)14(11,12)13/h5-7,9H,4H2,1-3H3,(H,11,12,13) |
| InChIKey | TVPORGCBFUNHDD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid?
The IUPAC name of 6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid (CID 175274217) is 6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid.
What is the SMILES notation for 6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid?
The canonical SMILES for 6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid is CCC1(C)C=CC=C(C)C1S(=O)(=O)O.
What is the InChIKey of 6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid?
The InChIKey is TVPORGCBFUNHDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3S/c1-4-10(3)7-5-6-8(2)9(10)14(11,12)13/h5-7,9H,4H2,1-3H3,(H,11,12,13).
What are the key properties of 6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid?
6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid has a molecular weight of 216.30 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid is sourced from PubChem (CID 175274217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).