About propyl 3-amino-4-propylbenzoate
propyl 3-amino-4-propylbenzoate (PubChem CID 175274272) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is propyl 3-amino-4-propylbenzoate.
Molecular Properties
| Compound Name | propyl 3-amino-4-propylbenzoate |
| PubChem CID | 175274272 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | propyl 3-amino-4-propylbenzoate |
| SMILES | CCCOC(=O)c1ccc(CCC)c(N)c1 |
| InChI | InChI=1S/C13H19NO2/c1-3-5-10-6-7-11(9-12(10)14)13(15)16-8-4-2/h6-7,9H,3-5,8,14H2,1-2H3 |
| InChIKey | ZZCPKCORMKGHMR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze propyl 3-amino-4-propylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-amino-4-propylbenzoate?
The IUPAC name of propyl 3-amino-4-propylbenzoate (CID 175274272) is propyl 3-amino-4-propylbenzoate.
What is the SMILES notation for propyl 3-amino-4-propylbenzoate?
The canonical SMILES for propyl 3-amino-4-propylbenzoate is CCCOC(=O)c1ccc(CCC)c(N)c1.
What is the InChIKey of propyl 3-amino-4-propylbenzoate?
The InChIKey is ZZCPKCORMKGHMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-3-5-10-6-7-11(9-12(10)14)13(15)16-8-4-2/h6-7,9H,3-5,8,14H2,1-2H3.
What are the key properties of propyl 3-amino-4-propylbenzoate?
propyl 3-amino-4-propylbenzoate has a molecular weight of 221.30 g/mol, XLogP of 2.79, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-amino-4-propylbenzoate is sourced from PubChem (CID 175274272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).