C31H31ClFN7O8 — CID 175274609
(3R)-4-[7-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-6-(2-fluoro-6-methoxyphenyl)-3-nitro-2-oxo-1,8-naphthyridin-4-yl]piperazine-1,3-dicarboxylic acid (PubChem CID 175274609) has the molecular formula C31H31ClFN7O8 and a molecular weight of 684.08 g/mol. Its IUPAC name is (3R)-4-[7-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-6-(2-fluoro-6-methoxyphenyl)-3-nitro-2-oxo-1,8-naphthyridin-4-yl]piperazine-1,3-dicarboxylic acid.
| Compound Name | (3R)-4-[7-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-6-(2-fluoro-6-methoxyphenyl)-3-nitro-2-oxo-1,8-naphthyridin-4-yl]piperazine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175274609 |
| Molecular Formula | C31H31ClFN7O8 |
| Molecular Weight | 684.08 g/mol |
| Exact Mass | 683.19 |
| IUPAC Name | (3R)-4-[7-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-6-(2-fluoro-6-methoxyphenyl)-3-nitro-2-oxo-1,8-naphthyridin-4-yl]piperazine-1,3-dicarboxylic acid |
| SMILES | COc1cccc(F)c1-c1cc2c(N3CCN(C(=O)O)C[C@@H]3C(=O)O)c([N+](=O)[O-])c(=O)n(-c3c(C(C)C)ncnc3C(C)C)c2nc1Cl |
| InChI | InChI=1S/C31H31ClFN7O8/c1-14(2)22-25(23(15(3)4)35-13-34-22)39-28-17(11-16(27(32)36-28)21-18(33)7-6-8-20(21)48-5)24(26(29(39)41)40(46)47)38-10-9-37(31(44)45)12-19(38)30(42)43/h6-8,11,13-15,19H,9-10,12H2,1-5H3,(H,42,43)(H,44,45)/t19-/m1/s1 |
| InChIKey | AGAIJIQONVSMRR-LJQANCHMSA-N |
| XLogP | 5.05 |
| TPSA | 194.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.08 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|