C45H44F2N4O3S2 — CID 175274735
2,4-bis[(2R)-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one (PubChem CID 175274735) has the molecular formula C45H44F2N4O3S2 and a molecular weight of 791.00 g/mol. Its IUPAC name is 2,4-bis[(2R)-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one.
| Compound Name | 2,4-bis[(2R)-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one |
|---|---|
| PubChem CID | 175274735 |
| Molecular Formula | C45H44F2N4O3S2 |
| Molecular Weight | 791.00 g/mol |
| Exact Mass | 790.28 |
| IUPAC Name | 2,4-bis[(2R)-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one |
| SMILES | O=C(C(COc1ccccc1)N1CCCC[C@@H]1c1csc(-c2ccc(F)cc2)n1)C(COc1ccccc1)N1CCCC[C@@H]1c1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C45H44F2N4O3S2/c46-33-21-17-31(18-22-33)44-48-37(29-55-44)39-15-7-9-25-50(39)41(27-53-35-11-3-1-4-12-35)43(52)42(28-54-36-13-5-2-6-14-36)51-26-10-8-16-40(51)38-30-56-45(49-38)32-19-23-34(47)24-20-32/h1-6,11-14,17-24,29-30,39-42H,7-10,15-16,25-28H2/t39-,40-,41?,42?/m1/s1 |
| InChIKey | OMYGIRWRVMMKOZ-PPSFMLEKSA-N |
| XLogP | 10.43 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.00 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |