C26H16N2O2 — CID 175275519
1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;perylene (PubChem CID 175275519) has the molecular formula C26H16N2O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;perylene.
| Compound Name | 1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;perylene |
|---|---|
| PubChem CID | 175275519 |
| Molecular Formula | C26H16N2O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;perylene |
| SMILES | O=C1Nc2cc[nH]c2C1=O.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.C6H4N2O2/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;9-5-4-3(1-2-7-4)8-6(5)10/h1-12H;1-2,7H,(H,8,9,10) |
| InChIKey | KGWIJXLFNBTVKN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|