C14H7Br2F3O4 — CID 175275604
2-bromo-4,5-difluorobenzoic acid;2-bromo-4-fluorobenzoic acid (PubChem CID 175275604) has the molecular formula C14H7Br2F3O4 and a molecular weight of 456.01 g/mol. Its IUPAC name is 2-bromo-4,5-difluorobenzoic acid;2-bromo-4-fluorobenzoic acid.
| Compound Name | 2-bromo-4,5-difluorobenzoic acid;2-bromo-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 175275604 |
| Molecular Formula | C14H7Br2F3O4 |
| Molecular Weight | 456.01 g/mol |
| Exact Mass | 453.87 |
| IUPAC Name | 2-bromo-4,5-difluorobenzoic acid;2-bromo-4-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)cc1Br.O=C(O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C7H3BrF2O2.C7H4BrFO2/c8-4-2-6(10)5(9)1-3(4)7(11)12;8-6-3-4(9)1-2-5(6)7(10)11/h1-2H,(H,11,12);1-3H,(H,10,11) |
| InChIKey | KTGRFQVHNJLBMG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.01 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|