About (5-phenyl-1,2,4-triazin-3-yl)methanesulfinate
(5-phenyl-1,2,4-triazin-3-yl)methanesulfinate (PubChem CID 175275811) has the molecular formula C10H8N3O2S-
and a molecular weight of 234.26 g/mol. Its IUPAC name is (5-phenyl-1,2,4-triazin-3-yl)methanesulfinate.
Molecular Properties
| Compound Name | (5-phenyl-1,2,4-triazin-3-yl)methanesulfinate |
| PubChem CID | 175275811 |
| Molecular Formula | C10H8N3O2S- |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | (5-phenyl-1,2,4-triazin-3-yl)methanesulfinate |
| SMILES | O=S([O-])Cc1nncc(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H9N3O2S/c14-16(15)7-10-12-9(6-11-13-10)8-4-2-1-3-5-8/h1-6H,7H2,(H,14,15)/p-1 |
| InChIKey | BIDUXZARPKENSV-UHFFFAOYSA-M |
| XLogP | 0.92 |
| TPSA | 78.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (5-phenyl-1,2,4-triazin-3-yl)methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-phenyl-1,2,4-triazin-3-yl)methanesulfinate?
The IUPAC name of (5-phenyl-1,2,4-triazin-3-yl)methanesulfinate (CID 175275811) is (5-phenyl-1,2,4-triazin-3-yl)methanesulfinate.
What is the SMILES notation for (5-phenyl-1,2,4-triazin-3-yl)methanesulfinate?
The canonical SMILES for (5-phenyl-1,2,4-triazin-3-yl)methanesulfinate is O=S([O-])Cc1nncc(-c2ccccc2)n1.
What is the InChIKey of (5-phenyl-1,2,4-triazin-3-yl)methanesulfinate?
The InChIKey is BIDUXZARPKENSV-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9N3O2S/c14-16(15)7-10-12-9(6-11-13-10)8-4-2-1-3-5-8/h1-6H,7H2,(H,14,15)/p-1.
What are the key properties of (5-phenyl-1,2,4-triazin-3-yl)methanesulfinate?
(5-phenyl-1,2,4-triazin-3-yl)methanesulfinate has a molecular weight of 234.26 g/mol, XLogP of 0.92, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-phenyl-1,2,4-triazin-3-yl)methanesulfinate is sourced from PubChem (CID 175275811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).