About propanoic acid;tetrabutyl(chloro)-λ5-phosphane
propanoic acid;tetrabutyl(chloro)-λ5-phosphane (PubChem CID 175277396) has the molecular formula C19H42ClO2P
and a molecular weight of 368.97 g/mol. Its IUPAC name is propanoic acid;tetrabutyl(chloro)-λ5-phosphane.
Molecular Properties
| Compound Name | propanoic acid;tetrabutyl(chloro)-λ5-phosphane |
| PubChem CID | 175277396 |
| Molecular Formula | C19H42ClO2P |
| Molecular Weight | 368.97 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | propanoic acid;tetrabutyl(chloro)-λ5-phosphane |
| SMILES | CCC(=O)O.CCCCP(Cl)(CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36ClP.C3H6O2/c1-5-9-13-18(17,14-10-6-2,15-11-7-3)16-12-8-4;1-2-3(4)5/h5-16H2,1-4H3;2H2,1H3,(H,4,5) |
| InChIKey | NVDOGBRBWYZGLI-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.97 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze propanoic acid;tetrabutyl(chloro)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoic acid;tetrabutyl(chloro)-λ5-phosphane?
The IUPAC name of propanoic acid;tetrabutyl(chloro)-λ5-phosphane (CID 175277396) is propanoic acid;tetrabutyl(chloro)-λ5-phosphane.
What is the SMILES notation for propanoic acid;tetrabutyl(chloro)-λ5-phosphane?
The canonical SMILES for propanoic acid;tetrabutyl(chloro)-λ5-phosphane is CCC(=O)O.CCCCP(Cl)(CCCC)(CCCC)CCCC.
What is the InChIKey of propanoic acid;tetrabutyl(chloro)-λ5-phosphane?
The InChIKey is NVDOGBRBWYZGLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36ClP.C3H6O2/c1-5-9-13-18(17,14-10-6-2,15-11-7-3)16-12-8-4;1-2-3(4)5/h5-16H2,1-4H3;2H2,1H3,(H,4,5).
What are the key properties of propanoic acid;tetrabutyl(chloro)-λ5-phosphane?
propanoic acid;tetrabutyl(chloro)-λ5-phosphane has a molecular weight of 368.97 g/mol, XLogP of 7.37, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propanoic acid;tetrabutyl(chloro)-λ5-phosphane is sourced from PubChem (CID 175277396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).