C20H25BN2O3 — CID 175277581
2-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)-2-pyridinyl]acetamide (PubChem CID 175277581) has the molecular formula C20H25BN2O3 and a molecular weight of 352.24 g/mol. Its IUPAC name is 2-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)-2-pyridinyl]acetamide.
| Compound Name | 2-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 175277581 |
| Molecular Formula | C20H25BN2O3 |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)-2-pyridinyl]acetamide |
| SMILES | CC1(C)COB(c2ccnc(NC(=O)Cc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C20H25BN2O3/c1-19(2)14-25-21(26-20(19,3)4)16-10-11-22-17(13-16)23-18(24)12-15-8-6-5-7-9-15/h5-11,13H,12,14H2,1-4H3,(H,22,23,24) |
| InChIKey | BPLJLOZNCXQPHN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|