About [1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate
[1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate (PubChem CID 175278128) has the molecular formula C9H16F2N2O2
and a molecular weight of 222.23 g/mol. Its IUPAC name is [1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate.
Molecular Properties
| Compound Name | [1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate |
| PubChem CID | 175278128 |
| Molecular Formula | C9H16F2N2O2 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | [1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate |
| SMILES | CC1(OC(N)=O)CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C9H16F2N2O2/c1-9(15-8(12)14)2-4-13(5-3-9)6-7(10)11/h7H,2-6H2,1H3,(H2,12,14) |
| InChIKey | WDBQWHMRIBJOOW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate?
The IUPAC name of [1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate (CID 175278128) is [1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate.
What is the SMILES notation for [1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate?
The canonical SMILES for [1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate is CC1(OC(N)=O)CCN(CC(F)F)CC1.
What is the InChIKey of [1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate?
The InChIKey is WDBQWHMRIBJOOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2N2O2/c1-9(15-8(12)14)2-4-13(5-3-9)6-7(10)11/h7H,2-6H2,1H3,(H2,12,14).
What are the key properties of [1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate?
[1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate has a molecular weight of 222.23 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-difluoroethyl)-4-methylpiperidin-4-yl] carbamate is sourced from PubChem (CID 175278128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).