About 5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium
5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium (PubChem CID 175279126) has the molecular formula C21H22Hf
and a molecular weight of 452.90 g/mol. Its IUPAC name is 5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium.
Molecular Properties
| Compound Name | 5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium |
| PubChem CID | 175279126 |
| Molecular Formula | C21H22Hf |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium |
| SMILES | CC1(C)Cc2cc3c(cc2C1)C(Cc1ccccc1)C=C3.[Hf] |
| InChI | InChI=1S/C21H22.Hf/c1-21(2)13-18-11-17-9-8-16(20(17)12-19(18)14-21)10-15-6-4-3-5-7-15;/h3-9,11-12,16H,10,13-14H2,1-2H3; |
| InChIKey | KCXDYTOBBIAKQP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium?
The IUPAC name of 5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium (CID 175279126) is 5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium.
What is the SMILES notation for 5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium?
The canonical SMILES for 5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium is CC1(C)Cc2cc3c(cc2C1)C(Cc1ccccc1)C=C3.[Hf].
What is the InChIKey of 5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium?
The InChIKey is KCXDYTOBBIAKQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22.Hf/c1-21(2)13-18-11-17-9-8-16(20(17)12-19(18)14-21)10-15-6-4-3-5-7-15;/h3-9,11-12,16H,10,13-14H2,1-2H3;.
What are the key properties of 5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium?
5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium has a molecular weight of 452.90 g/mol, XLogP of 5.16, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-2,2-dimethyl-3,5-dihydro-1H-s-indacene;hafnium is sourced from PubChem (CID 175279126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).