About 5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium
5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium (PubChem CID 175279272) has the molecular formula C18H23Hf-
and a molecular weight of 417.87 g/mol. Its IUPAC name is 5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium.
Molecular Properties
| Compound Name | 5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium |
| PubChem CID | 175279272 |
| Molecular Formula | C18H23Hf- |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium |
| SMILES | CCC(C)[c-]1ccc2cc3c(cc21)CC(C)(C)C3.[Hf] |
| InChI | InChI=1S/C18H23.Hf/c1-5-12(2)16-7-6-13-8-14-10-18(3,4)11-15(14)9-17(13)16;/h6-9,12H,5,10-11H2,1-4H3;/q-1; |
| InChIKey | UCDDMOVAKPAYFH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium?
The IUPAC name of 5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium (CID 175279272) is 5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium.
What is the SMILES notation for 5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium?
The canonical SMILES for 5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium is CCC(C)[c-]1ccc2cc3c(cc21)CC(C)(C)C3.[Hf].
What is the InChIKey of 5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium?
The InChIKey is UCDDMOVAKPAYFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23.Hf/c1-5-12(2)16-7-6-13-8-14-10-18(3,4)11-15(14)9-17(13)16;/h6-9,12H,5,10-11H2,1-4H3;/q-1;.
What are the key properties of 5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium?
5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium has a molecular weight of 417.87 g/mol, XLogP of 5.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-2,2-dimethyl-1,3-dihydro-s-indacen-5-ide;hafnium is sourced from PubChem (CID 175279272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).