C13H16N8O5 — CID 175279315
(4R)-2-diazo-3-oxo-4-[(2R,3R)-4-oxo-3-[(1R)-1-[[2-(tetrazol-1-yl)acetyl]amino]ethyl]azetidin-2-yl]pentanoic acid (PubChem CID 175279315) has the molecular formula C13H16N8O5 and a molecular weight of 364.32 g/mol. Its IUPAC name is (4R)-2-diazo-3-oxo-4-[(2R,3R)-4-oxo-3-[(1R)-1-[[2-(tetrazol-1-yl)acetyl]amino]ethyl]azetidin-2-yl]pentanoic acid.
| Compound Name | (4R)-2-diazo-3-oxo-4-[(2R,3R)-4-oxo-3-[(1R)-1-[[2-(tetrazol-1-yl)acetyl]amino]ethyl]azetidin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 175279315 |
| Molecular Formula | C13H16N8O5 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (4R)-2-diazo-3-oxo-4-[(2R,3R)-4-oxo-3-[(1R)-1-[[2-(tetrazol-1-yl)acetyl]amino]ethyl]azetidin-2-yl]pentanoic acid |
| SMILES | C[C@@H](NC(=O)Cn1cnnn1)[C@H]1C(=O)N[C@@H]1[C@@H](C)C(=O)C(=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C13H16N8O5/c1-5(11(23)10(18-14)13(25)26)9-8(12(24)17-9)6(2)16-7(22)3-21-4-15-19-20-21/h4-6,8-9H,3H2,1-2H3,(H,16,22)(H,17,24)(H,25,26)/t5-,6-,8-,9-/m1/s1 |
| InChIKey | PGUKNFPYGKZZAG-SQEXRHODSA-N |
| XLogP | -2.75 |
| TPSA | 192.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|