C21H38BN3O4 — CID 175279359
tert-butyl formate;4-[5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)pyrazol-1-yl]piperidine (PubChem CID 175279359) has the molecular formula C21H38BN3O4 and a molecular weight of 407.36 g/mol. Its IUPAC name is tert-butyl formate;4-[5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)pyrazol-1-yl]piperidine.
| Compound Name | tert-butyl formate;4-[5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)pyrazol-1-yl]piperidine |
|---|---|
| PubChem CID | 175279359 |
| Molecular Formula | C21H38BN3O4 |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | tert-butyl formate;4-[5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)pyrazol-1-yl]piperidine |
| SMILES | CC(C)(C)OC=O.Cc1c(B2OCC(C)(C)C(C)(C)O2)cnn1C1CCNCC1 |
| InChI | InChI=1S/C16H28BN3O2.C5H10O2/c1-12-14(10-19-20(12)13-6-8-18-9-7-13)17-21-11-15(2,3)16(4,5)22-17;1-5(2,3)7-4-6/h10,13,18H,6-9,11H2,1-5H3;4H,1-3H3 |
| InChIKey | OOHNPLFPNFQBKX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|