C27H34N2O2S — CID 175279380
1-benzyl-6-[1-(1-cyclobutylprop-2-enylsulfonyl)azetidin-3-yl]-N-methyl-2,3-dihydro-1H-inden-2-amine (PubChem CID 175279380) has the molecular formula C27H34N2O2S and a molecular weight of 450.65 g/mol. Its IUPAC name is 1-benzyl-6-[1-(1-cyclobutylprop-2-enylsulfonyl)azetidin-3-yl]-N-methyl-2,3-dihydro-1H-inden-2-amine.
| Compound Name | 1-benzyl-6-[1-(1-cyclobutylprop-2-enylsulfonyl)azetidin-3-yl]-N-methyl-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 175279380 |
| Molecular Formula | C27H34N2O2S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 1-benzyl-6-[1-(1-cyclobutylprop-2-enylsulfonyl)azetidin-3-yl]-N-methyl-2,3-dihydro-1H-inden-2-amine |
| SMILES | C=CC(C1CCC1)S(=O)(=O)N1CC(c2ccc3c(c2)C(Cc2ccccc2)C(NC)C3)C1 |
| InChI | InChI=1S/C27H34N2O2S/c1-3-27(20-10-7-11-20)32(30,31)29-17-23(18-29)21-12-13-22-16-26(28-2)25(24(22)15-21)14-19-8-5-4-6-9-19/h3-6,8-9,12-13,15,20,23,25-28H,1,7,10-11,14,16-18H2,2H3 |
| InChIKey | DFFNIGGAYRFAKQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|