C23H21F6NO5 — CID 175279746
3-amino-2-methyl-4-(2,4,5-trifluorophenyl)butanoic acid;2-methyl-4-oxo-3-[(2,4,5-trifluorophenyl)methyl]but-3-enoic acid (PubChem CID 175279746) has the molecular formula C23H21F6NO5 and a molecular weight of 505.41 g/mol. Its IUPAC name is 3-amino-2-methyl-4-(2,4,5-trifluorophenyl)butanoic acid;2-methyl-4-oxo-3-[(2,4,5-trifluorophenyl)methyl]but-3-enoic acid.
| Compound Name | 3-amino-2-methyl-4-(2,4,5-trifluorophenyl)butanoic acid;2-methyl-4-oxo-3-[(2,4,5-trifluorophenyl)methyl]but-3-enoic acid |
|---|---|
| PubChem CID | 175279746 |
| Molecular Formula | C23H21F6NO5 |
| Molecular Weight | 505.41 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 3-amino-2-methyl-4-(2,4,5-trifluorophenyl)butanoic acid;2-methyl-4-oxo-3-[(2,4,5-trifluorophenyl)methyl]but-3-enoic acid |
| SMILES | CC(C(=O)O)C(=C=O)Cc1cc(F)c(F)cc1F.CC(C(=O)O)C(N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H9F3O3.C11H12F3NO2/c1-6(12(17)18)8(5-16)2-7-3-10(14)11(15)4-9(7)13;1-5(11(16)17)10(15)3-6-2-8(13)9(14)4-7(6)12/h3-4,6H,2H2,1H3,(H,17,18);2,4-5,10H,3,15H2,1H3,(H,16,17) |
| InChIKey | PWSORBIJSBKHSI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|