C27H24N4O3S2 — CID 175280059
4-[1-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enylsulfonyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 175280059) has the molecular formula C27H24N4O3S2 and a molecular weight of 516.65 g/mol. Its IUPAC name is 4-[1-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enylsulfonyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[1-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enylsulfonyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 175280059 |
| Molecular Formula | C27H24N4O3S2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 4-[1-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-enylsulfonyl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | C=CC(N1CCc2ccccc2C1)S(=O)(=O)c1ccc(C(=O)Nc2nc(-c3cccnc3)cs2)cc1 |
| InChI | InChI=1S/C27H24N4O3S2/c1-2-25(31-15-13-19-6-3-4-7-22(19)17-31)36(33,34)23-11-9-20(10-12-23)26(32)30-27-29-24(18-35-27)21-8-5-14-28-16-21/h2-12,14,16,18,25H,1,13,15,17H2,(H,29,30,32) |
| InChIKey | CLNFRRLTCCQADK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|