About 2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline
2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline (PubChem CID 175280489) has the molecular formula C20H28N4O3
and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline.
Molecular Properties
| Compound Name | 2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline |
| PubChem CID | 175280489 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline |
| SMILES | CC(C(=O)O)N(C)C.Cc1nccn1CCO.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C6H10N2O.C5H11NO2/c1-2-6-9-8(4-1)5-3-7-10-9;1-6-7-2-3-8(6)4-5-9;1-4(5(7)8)6(2)3/h1-7H;2-3,9H,4-5H2,1H3;4H,1-3H3,(H,7,8) |
| InChIKey | DDRBMUPBQGLBHC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline?
The IUPAC name of 2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline (CID 175280489) is 2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline.
What is the SMILES notation for 2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline?
The canonical SMILES for 2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline is CC(C(=O)O)N(C)C.Cc1nccn1CCO.c1ccc2ncccc2c1.
What is the InChIKey of 2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline?
The InChIKey is DDRBMUPBQGLBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C6H10N2O.C5H11NO2/c1-2-6-9-8(4-1)5-3-7-10-9;1-6-7-2-3-8(6)4-5-9;1-4(5(7)8)6(2)3/h1-7H;2-3,9H,4-5H2,1H3;4H,1-3H3,(H,7,8).
What are the key properties of 2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline?
2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline has a molecular weight of 372.47 g/mol, XLogP of 2.44, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)propanoic acid;2-(2-methylimidazol-1-yl)ethanol;quinoline is sourced from PubChem (CID 175280489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).