2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid

C15H21NO2 — CID 175280614

IUPAC2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid
SMILESCc1cc(C)cc(C2CNCC(CC(=O)O)C2)c1
InChIInChI=1S/C15H21NO2/c1-10-3-11(2)5-13(4-10)14-6-12(7-15(17)18)8-16-9-14/h3-5,12,14,16H,6-9H2,1-2H3,(H,17,18)
InChIKeyOJQZPPFDENHNQF-UHFFFAOYSA-N
MW247.34 g/mol
LogP2.47
Rot. Bonds3

About 2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid

2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid (PubChem CID 175280614) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid
PubChem CID175280614
Molecular FormulaC15H21NO2
Molecular Weight247.34 g/mol
Exact Mass247.16
IUPAC Name2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid
SMILESCc1cc(C)cc(C2CNCC(CC(=O)O)C2)c1
InChIInChI=1S/C15H21NO2/c1-10-3-11(2)5-13(4-10)14-6-12(7-15(17)18)8-16-9-14/h3-5,12,14,16H,6-9H2,1-2H3,(H,17,18)
InChIKeyOJQZPPFDENHNQF-UHFFFAOYSA-N
XLogP2.47
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.34
LogP ≤ 52.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid?
The IUPAC name of 2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid (CID 175280614) is 2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid.
What is the SMILES notation for 2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid?
The canonical SMILES for 2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid is Cc1cc(C)cc(C2CNCC(CC(=O)O)C2)c1.
What is the InChIKey of 2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid?
The InChIKey is OJQZPPFDENHNQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-10-3-11(2)5-13(4-10)14-6-12(7-15(17)18)8-16-9-14/h3-5,12,14,16H,6-9H2,1-2H3,(H,17,18).
What are the key properties of 2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid?
2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid has a molecular weight of 247.34 g/mol, XLogP of 2.47, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(3,5-dimethylphenyl)piperidin-3-yl]acetic acid is sourced from PubChem (CID 175280614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).