About anisole;[methoxy(methyl)phosphoryl]oxymethane
anisole;[methoxy(methyl)phosphoryl]oxymethane (PubChem CID 175280701) has the molecular formula C17H25O5P
and a molecular weight of 340.36 g/mol. Its IUPAC name is anisole;[methoxy(methyl)phosphoryl]oxymethane.
Molecular Properties
| Compound Name | anisole;[methoxy(methyl)phosphoryl]oxymethane |
| PubChem CID | 175280701 |
| Molecular Formula | C17H25O5P |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | anisole;[methoxy(methyl)phosphoryl]oxymethane |
| SMILES | COP(C)(=O)OC.COc1ccccc1.COc1ccccc1 |
| InChI | InChI=1S/2C7H8O.C3H9O3P/c2*1-8-7-5-3-2-4-6-7;1-5-7(3,4)6-2/h2*2-6H,1H3;1-3H3 |
| InChIKey | WKVXWBSDOPRTMD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze anisole;[methoxy(methyl)phosphoryl]oxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;[methoxy(methyl)phosphoryl]oxymethane?
The IUPAC name of anisole;[methoxy(methyl)phosphoryl]oxymethane (CID 175280701) is anisole;[methoxy(methyl)phosphoryl]oxymethane.
What is the SMILES notation for anisole;[methoxy(methyl)phosphoryl]oxymethane?
The canonical SMILES for anisole;[methoxy(methyl)phosphoryl]oxymethane is COP(C)(=O)OC.COc1ccccc1.COc1ccccc1.
What is the InChIKey of anisole;[methoxy(methyl)phosphoryl]oxymethane?
The InChIKey is WKVXWBSDOPRTMD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8O.C3H9O3P/c2*1-8-7-5-3-2-4-6-7;1-5-7(3,4)6-2/h2*2-6H,1H3;1-3H3.
What are the key properties of anisole;[methoxy(methyl)phosphoryl]oxymethane?
anisole;[methoxy(methyl)phosphoryl]oxymethane has a molecular weight of 340.36 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;[methoxy(methyl)phosphoryl]oxymethane is sourced from PubChem (CID 175280701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).