About [4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate
[4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate (PubChem CID 175280962) has the molecular formula C8H9F3N2O2
and a molecular weight of 222.17 g/mol. Its IUPAC name is [4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate.
Molecular Properties
| Compound Name | [4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate |
| PubChem CID | 175280962 |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | [4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate |
| SMILES | O=COC(Cc1cn[nH]c1)CC(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O2/c9-8(10,11)2-7(15-5-14)1-6-3-12-13-4-6/h3-5,7H,1-2H2,(H,12,13) |
| InChIKey | OYCJNIPCWIZZIG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate?
The IUPAC name of [4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate (CID 175280962) is [4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate.
What is the SMILES notation for [4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate?
The canonical SMILES for [4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate is O=COC(Cc1cn[nH]c1)CC(F)(F)F.
What is the InChIKey of [4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate?
The InChIKey is OYCJNIPCWIZZIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O2/c9-8(10,11)2-7(15-5-14)1-6-3-12-13-4-6/h3-5,7H,1-2H2,(H,12,13).
What are the key properties of [4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate?
[4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate has a molecular weight of 222.17 g/mol, XLogP of 1.45, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4,4-trifluoro-1-(1H-pyrazol-4-yl)butan-2-yl] formate is sourced from PubChem (CID 175280962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).