C38H40ClN9O7 — CID 175282119
ditert-butyl 5-[[3-(4-aminophenyl)-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]propanoyl]amino]indole-1,2-dicarboxylate (PubChem CID 175282119) has the molecular formula C38H40ClN9O7 and a molecular weight of 770.25 g/mol. Its IUPAC name is ditert-butyl 5-[[3-(4-aminophenyl)-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]propanoyl]amino]indole-1,2-dicarboxylate.
| Compound Name | ditert-butyl 5-[[3-(4-aminophenyl)-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]propanoyl]amino]indole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 175282119 |
| Molecular Formula | C38H40ClN9O7 |
| Molecular Weight | 770.25 g/mol |
| Exact Mass | 769.27 |
| IUPAC Name | ditert-butyl 5-[[3-(4-aminophenyl)-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,3-dioxopiperazin-1-yl]propanoyl]amino]indole-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc2cc(NC(=O)C(Cc3ccc(N)cc3)N3CCN(c4cc(Cl)ccc4-n4cnnn4)C(=O)C3=O)ccc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H40ClN9O7/c1-37(2,3)54-35(52)31-19-23-18-26(12-14-27(23)48(31)36(53)55-38(4,5)6)42-32(49)30(17-22-7-10-25(40)11-8-22)46-16-15-45(33(50)34(46)51)29-20-24(39)9-13-28(29)47-21-41-43-44-47/h7-14,18-21,30H,15-17,40H2,1-6H3,(H,42,49) |
| InChIKey | KYDBDEZQRRCJKD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.25 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|