C20H21FN4O2 — CID 175282629
5-(2-fluoro-3-pyridinyl)-N-(2-morpholin-4-ylethyl)-1H-indole-3-carboxamide (PubChem CID 175282629) has the molecular formula C20H21FN4O2 and a molecular weight of 368.41 g/mol. Its IUPAC name is 5-(2-fluoro-3-pyridinyl)-N-(2-morpholin-4-ylethyl)-1H-indole-3-carboxamide.
| Compound Name | 5-(2-fluoro-3-pyridinyl)-N-(2-morpholin-4-ylethyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 175282629 |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 5-(2-fluoro-3-pyridinyl)-N-(2-morpholin-4-ylethyl)-1H-indole-3-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)c1c[nH]c2ccc(-c3cccnc3F)cc12 |
| InChI | InChI=1S/C20H21FN4O2/c21-19-15(2-1-5-22-19)14-3-4-18-16(12-14)17(13-24-18)20(26)23-6-7-25-8-10-27-11-9-25/h1-5,12-13,24H,6-11H2,(H,23,26) |
| InChIKey | TVKCLAYJQBPWMS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|