About (2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid
(2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid (PubChem CID 175282713) has the molecular formula C16H19N3O2
and a molecular weight of 285.35 g/mol. Its IUPAC name is (2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid.
Molecular Properties
| Compound Name | (2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid |
| PubChem CID | 175282713 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)O)[C@@H](C)CN1c1cccc2cccnc12 |
| InChI | InChI=1S/C16H19N3O2/c1-11-10-19(16(20)21)12(2)9-18(11)14-7-3-5-13-6-4-8-17-15(13)14/h3-8,11-12H,9-10H2,1-2H3,(H,20,21)/t11-,12+/m1/s1 |
| InChIKey | UEPTWNKWPZNZOS-NEPJUHHUSA-N |
| XLogP | 2.81 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid?
The IUPAC name of (2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid (CID 175282713) is (2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid.
What is the SMILES notation for (2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid?
The canonical SMILES for (2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid is C[C@@H]1CN(C(=O)O)[C@@H](C)CN1c1cccc2cccnc12.
What is the InChIKey of (2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid?
The InChIKey is UEPTWNKWPZNZOS-NEPJUHHUSA-N. The full InChI is InChI=1S/C16H19N3O2/c1-11-10-19(16(20)21)12(2)9-18(11)14-7-3-5-13-6-4-8-17-15(13)14/h3-8,11-12H,9-10H2,1-2H3,(H,20,21)/t11-,12+/m1/s1.
What are the key properties of (2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid?
(2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid has a molecular weight of 285.35 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-2,5-dimethyl-4-quinolin-8-ylpiperazine-1-carboxylic acid is sourced from PubChem (CID 175282713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).