C33H28N4O2 — CID 175283001
2,4-dimethyl-3-nitro-6-(5,6,7,8-tetrahydrochrysen-6-yl)pyridine;1,6-naphthyridine (PubChem CID 175283001) has the molecular formula C33H28N4O2 and a molecular weight of 512.61 g/mol. Its IUPAC name is 2,4-dimethyl-3-nitro-6-(5,6,7,8-tetrahydrochrysen-6-yl)pyridine;1,6-naphthyridine.
| Compound Name | 2,4-dimethyl-3-nitro-6-(5,6,7,8-tetrahydrochrysen-6-yl)pyridine;1,6-naphthyridine |
|---|---|
| PubChem CID | 175283001 |
| Molecular Formula | C33H28N4O2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 2,4-dimethyl-3-nitro-6-(5,6,7,8-tetrahydrochrysen-6-yl)pyridine;1,6-naphthyridine |
| SMILES | Cc1cc(C2Cc3c(ccc4ccccc34)C3=C2CCC=C3)nc(C)c1[N+](=O)[O-].c1cnc2ccncc2c1 |
| InChI | InChI=1S/C25H22N2O2.C8H6N2/c1-15-13-24(26-16(2)25(15)27(28)29)23-14-22-18-8-4-3-7-17(18)11-12-21(22)19-9-5-6-10-20(19)23;1-2-7-6-9-5-3-8(7)10-4-1/h3-5,7-9,11-13,23H,6,10,14H2,1-2H3;1-6H |
| InChIKey | ZUBMBHYSVTWAQK-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|