C20H24F2N2O5 — CID 175283231
3-[2-amino-3-(2,4-difluorophenyl)propanoyl]-1-(2,2-dimethoxyethyl)-5-ethoxypyridin-4-one (PubChem CID 175283231) has the molecular formula C20H24F2N2O5 and a molecular weight of 410.42 g/mol. Its IUPAC name is 3-[2-amino-3-(2,4-difluorophenyl)propanoyl]-1-(2,2-dimethoxyethyl)-5-ethoxypyridin-4-one.
| Compound Name | 3-[2-amino-3-(2,4-difluorophenyl)propanoyl]-1-(2,2-dimethoxyethyl)-5-ethoxypyridin-4-one |
|---|---|
| PubChem CID | 175283231 |
| Molecular Formula | C20H24F2N2O5 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 3-[2-amino-3-(2,4-difluorophenyl)propanoyl]-1-(2,2-dimethoxyethyl)-5-ethoxypyridin-4-one |
| SMILES | CCOc1cn(CC(OC)OC)cc(C(=O)C(N)Cc2ccc(F)cc2F)c1=O |
| InChI | InChI=1S/C20H24F2N2O5/c1-4-29-17-10-24(11-18(27-2)28-3)9-14(20(17)26)19(25)16(23)7-12-5-6-13(21)8-15(12)22/h5-6,8-10,16,18H,4,7,11,23H2,1-3H3 |
| InChIKey | CYKNNUJQFBGNCA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|