About 5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate
5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate (PubChem CID 175283809) has the molecular formula C19H16F3N3O7S
and a molecular weight of 487.41 g/mol. Its IUPAC name is 5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate |
| PubChem CID | 175283809 |
| Molecular Formula | C19H16F3N3O7S |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate |
| SMILES | Cc1c(N)cc(C(=O)O)cc1C(=O)O.O=S(=O)(Oc1ccn(-c2ccccc2)n1)C(F)(F)F |
| InChI | InChI=1S/C10H7F3N2O3S.C9H9NO4/c11-10(12,13)19(16,17)18-9-6-7-15(14-9)8-4-2-1-3-5-8;1-4-6(9(13)14)2-5(8(11)12)3-7(4)10/h1-7H;2-3H,10H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | ZUYLLXKNUWGZMI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 161.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate?
The IUPAC name of 5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate (CID 175283809) is 5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate.
What is the SMILES notation for 5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate?
The canonical SMILES for 5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate is Cc1c(N)cc(C(=O)O)cc1C(=O)O.O=S(=O)(Oc1ccn(-c2ccccc2)n1)C(F)(F)F.
What is the InChIKey of 5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate?
The InChIKey is ZUYLLXKNUWGZMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3N2O3S.C9H9NO4/c11-10(12,13)19(16,17)18-9-6-7-15(14-9)8-4-2-1-3-5-8;1-4-6(9(13)14)2-5(8(11)12)3-7(4)10/h1-7H;2-3H,10H2,1H3,(H,11,12)(H,13,14).
What are the key properties of 5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate?
5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate has a molecular weight of 487.41 g/mol, XLogP of 3.07, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-methylbenzene-1,3-dicarboxylic acid;(1-phenylpyrazol-3-yl) trifluoromethanesulfonate is sourced from PubChem (CID 175283809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).