C42H48O8 — CID 175284111
6,7-bis[2-methoxy-2-(3,4,5-trimethoxyphenyl)ethyl]-1,2,3,4-tetrahydrochrysene (PubChem CID 175284111) has the molecular formula C42H48O8 and a molecular weight of 680.84 g/mol. Its IUPAC name is 6,7-bis[2-methoxy-2-(3,4,5-trimethoxyphenyl)ethyl]-1,2,3,4-tetrahydrochrysene.
| Compound Name | 6,7-bis[2-methoxy-2-(3,4,5-trimethoxyphenyl)ethyl]-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 175284111 |
| Molecular Formula | C42H48O8 |
| Molecular Weight | 680.84 g/mol |
| Exact Mass | 680.33 |
| IUPAC Name | 6,7-bis[2-methoxy-2-(3,4,5-trimethoxyphenyl)ethyl]-1,2,3,4-tetrahydrochrysene |
| SMILES | COc1cc(C(Cc2cccc3c2c(CC(OC)c2cc(OC)c(OC)c(OC)c2)cc2c4c(ccc23)CCCC4)OC)cc(OC)c1OC |
| InChI | InChI=1S/C42H48O8/c1-43-34(27-20-36(45-3)41(49-7)37(21-27)46-4)19-26-13-11-15-32-31-17-16-25-12-9-10-14-30(25)33(31)18-29(40(26)32)24-35(44-2)28-22-38(47-5)42(50-8)39(23-28)48-6/h11,13,15-18,20-23,34-35H,9-10,12,14,19,24H2,1-8H3 |
| InChIKey | DUQSDDTVMFGMKL-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.84 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|