About 4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole
4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole (PubChem CID 175284626) has the molecular formula C27H20BrFN2
and a molecular weight of 471.37 g/mol. Its IUPAC name is 4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole.
Molecular Properties
| Compound Name | 4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole |
| PubChem CID | 175284626 |
| Molecular Formula | C27H20BrFN2 |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole |
| SMILES | CCc1c(F)c(-c2ccccc2)c2nn(-c3ccccc3)c(-c3ccccc3)c2c1Br |
| InChI | InChI=1S/C27H20BrFN2/c1-2-21-24(28)23-26(22(25(21)29)18-12-6-3-7-13-18)30-31(20-16-10-5-11-17-20)27(23)19-14-8-4-9-15-19/h3-17H,2H2,1H3 |
| InChIKey | PEGNUJAXJCWYMJ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole?
The IUPAC name of 4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole (CID 175284626) is 4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole.
What is the SMILES notation for 4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole?
The canonical SMILES for 4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole is CCc1c(F)c(-c2ccccc2)c2nn(-c3ccccc3)c(-c3ccccc3)c2c1Br.
What is the InChIKey of 4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole?
The InChIKey is PEGNUJAXJCWYMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20BrFN2/c1-2-21-24(28)23-26(22(25(21)29)18-12-6-3-7-13-18)30-31(20-16-10-5-11-17-20)27(23)19-14-8-4-9-15-19/h3-17H,2H2,1H3.
What are the key properties of 4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole?
4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole has a molecular weight of 471.37 g/mol, XLogP of 7.82, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-ethyl-6-fluoro-2,3,7-triphenylindazole is sourced from PubChem (CID 175284626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).