C20H23N7O6 — CID 175284915
1-amino-1-[4-[amino(carbamoyl)amino]-2-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-5-methoxyphenyl]urea (PubChem CID 175284915) has the molecular formula C20H23N7O6 and a molecular weight of 457.45 g/mol. Its IUPAC name is 1-amino-1-[4-[amino(carbamoyl)amino]-2-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-5-methoxyphenyl]urea.
| Compound Name | 1-amino-1-[4-[amino(carbamoyl)amino]-2-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-5-methoxyphenyl]urea |
|---|---|
| PubChem CID | 175284915 |
| Molecular Formula | C20H23N7O6 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 1-amino-1-[4-[amino(carbamoyl)amino]-2-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-5-methoxyphenyl]urea |
| SMILES | COc1cc(OC)cc(-c2ncoc2-c2cc(N(N)C(N)=O)c(OC)cc2N(N)C(N)=O)c1 |
| InChI | InChI=1S/C20H23N7O6/c1-30-11-4-10(5-12(6-11)31-2)17-18(33-9-25-17)13-7-15(27(24)20(22)29)16(32-3)8-14(13)26(23)19(21)28/h4-9H,23-24H2,1-3H3,(H2,21,28)(H2,22,29) |
| InChIKey | MFBLKMINRZFBHE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 198.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|