About 2-benzofuran;ethenone
2-benzofuran;ethenone (PubChem CID 175285039) has the molecular formula C10H8O2
and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-benzofuran;ethenone.
Molecular Properties
| Compound Name | 2-benzofuran;ethenone |
| PubChem CID | 175285039 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 2-benzofuran;ethenone |
| SMILES | C=C=O.c1ccc2cocc2c1 |
| InChI | InChI=1S/C8H6O.C2H2O/c1-2-4-8-6-9-5-7(8)3-1;1-2-3/h1-6H;1H2 |
| InChIKey | CHNQSIGIQYIROE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 2-benzofuran;ethenone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzofuran;ethenone?
The IUPAC name of 2-benzofuran;ethenone (CID 175285039) is 2-benzofuran;ethenone.
What is the SMILES notation for 2-benzofuran;ethenone?
The canonical SMILES for 2-benzofuran;ethenone is C=C=O.c1ccc2cocc2c1.
What is the InChIKey of 2-benzofuran;ethenone?
The InChIKey is CHNQSIGIQYIROE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.C2H2O/c1-2-4-8-6-9-5-7(8)3-1;1-2-3/h1-6H;1H2.
What are the key properties of 2-benzofuran;ethenone?
2-benzofuran;ethenone has a molecular weight of 160.17 g/mol, XLogP of 2.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzofuran;ethenone is sourced from PubChem (CID 175285039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).