About 3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole
3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole (PubChem CID 175286050) has the molecular formula C17H22N4S
and a molecular weight of 314.46 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole.
Molecular Properties
| Compound Name | 3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole |
| PubChem CID | 175286050 |
| Molecular Formula | C17H22N4S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole |
| SMILES | CC1=CN(Cc2ccn3ccnc3c2)C(C2CCNCC2)S1 |
| InChI | InChI=1S/C17H22N4S/c1-13-11-21(17(22-13)15-2-5-18-6-3-15)12-14-4-8-20-9-7-19-16(20)10-14/h4,7-11,15,17-18H,2-3,5-6,12H2,1H3 |
| InChIKey | AEJDQZPGLKIZAK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole?
The IUPAC name of 3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole (CID 175286050) is 3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole.
What is the SMILES notation for 3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole?
The canonical SMILES for 3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole is CC1=CN(Cc2ccn3ccnc3c2)C(C2CCNCC2)S1.
What is the InChIKey of 3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole?
The InChIKey is AEJDQZPGLKIZAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4S/c1-13-11-21(17(22-13)15-2-5-18-6-3-15)12-14-4-8-20-9-7-19-16(20)10-14/h4,7-11,15,17-18H,2-3,5-6,12H2,1H3.
What are the key properties of 3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole?
3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole has a molecular weight of 314.46 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(imidazo[1,2-a]pyridin-7-ylmethyl)-5-methyl-2-piperidin-4-yl-2H-1,3-thiazole is sourced from PubChem (CID 175286050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).