About 2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride
2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride (PubChem CID 175286170) has the molecular formula C13H16ClN5O2
and a molecular weight of 309.76 g/mol. Its IUPAC name is 2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride.
Molecular Properties
| Compound Name | 2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride |
| PubChem CID | 175286170 |
| Molecular Formula | C13H16ClN5O2 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride |
| SMILES | Cl.NC(N)=Nc1ccc(-c2cc(CCOC=O)[nH]n2)cc1 |
| InChI | InChI=1S/C13H15N5O2.ClH/c14-13(15)16-10-3-1-9(2-4-10)12-7-11(17-18-12)5-6-20-8-19;/h1-4,7-8H,5-6H2,(H,17,18)(H4,14,15,16);1H |
| InChIKey | OEPIMTASAWXFBT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride?
The IUPAC name of 2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride (CID 175286170) is 2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride.
What is the SMILES notation for 2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride?
The canonical SMILES for 2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride is Cl.NC(N)=Nc1ccc(-c2cc(CCOC=O)[nH]n2)cc1.
What is the InChIKey of 2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride?
The InChIKey is OEPIMTASAWXFBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5O2.ClH/c14-13(15)16-10-3-1-9(2-4-10)12-7-11(17-18-12)5-6-20-8-19;/h1-4,7-8H,5-6H2,(H,17,18)(H4,14,15,16);1H.
What are the key properties of 2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride?
2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride has a molecular weight of 309.76 g/mol, XLogP of 1.12, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[4-(diaminomethylideneamino)phenyl]-1H-pyrazol-5-yl]ethyl formate;hydrochloride is sourced from PubChem (CID 175286170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).