C19H18Cl2N6O3 — CID 175286202
bis[5-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-2,4-dimethyl-1H-pyrrol-3-yl]methanone (PubChem CID 175286202) has the molecular formula C19H18Cl2N6O3 and a molecular weight of 449.30 g/mol. Its IUPAC name is bis[5-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-2,4-dimethyl-1H-pyrrol-3-yl]methanone.
| Compound Name | bis[5-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-2,4-dimethyl-1H-pyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 175286202 |
| Molecular Formula | C19H18Cl2N6O3 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | bis[5-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-2,4-dimethyl-1H-pyrrol-3-yl]methanone |
| SMILES | Cc1[nH]c(-c2nnc(CCl)o2)c(C)c1C(=O)c1c(C)[nH]c(-c2nnc(CCl)o2)c1C |
| InChI | InChI=1S/C19H18Cl2N6O3/c1-7-13(9(3)22-15(7)18-26-24-11(5-20)29-18)17(28)14-8(2)16(23-10(14)4)19-27-25-12(6-21)30-19/h22-23H,5-6H2,1-4H3 |
| InChIKey | JFPDDSCNJCINKJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|