About 1-butoxyoctane;sulfuric acid;zinc
1-butoxyoctane;sulfuric acid;zinc (PubChem CID 175286221) has the molecular formula C12H28O5SZn
and a molecular weight of 349.81 g/mol. Its IUPAC name is 1-butoxyoctane;sulfuric acid;zinc.
Molecular Properties
| Compound Name | 1-butoxyoctane;sulfuric acid;zinc |
| PubChem CID | 175286221 |
| Molecular Formula | C12H28O5SZn |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-butoxyoctane;sulfuric acid;zinc |
| SMILES | CCCCCCCCOCCCC.O=S(=O)(O)O.[Zn] |
| InChI | InChI=1S/C12H26O.H2O4S.Zn/c1-3-5-7-8-9-10-12-13-11-6-4-2;1-5(2,3)4;/h3-12H2,1-2H3;(H2,1,2,3,4); |
| InChIKey | LCLLCHZFUOARMI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxyoctane;sulfuric acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxyoctane;sulfuric acid;zinc?
The IUPAC name of 1-butoxyoctane;sulfuric acid;zinc (CID 175286221) is 1-butoxyoctane;sulfuric acid;zinc.
What is the SMILES notation for 1-butoxyoctane;sulfuric acid;zinc?
The canonical SMILES for 1-butoxyoctane;sulfuric acid;zinc is CCCCCCCCOCCCC.O=S(=O)(O)O.[Zn].
What is the InChIKey of 1-butoxyoctane;sulfuric acid;zinc?
The InChIKey is LCLLCHZFUOARMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O.H2O4S.Zn/c1-3-5-7-8-9-10-12-13-11-6-4-2;1-5(2,3)4;/h3-12H2,1-2H3;(H2,1,2,3,4);.
What are the key properties of 1-butoxyoctane;sulfuric acid;zinc?
1-butoxyoctane;sulfuric acid;zinc has a molecular weight of 349.81 g/mol, XLogP of 3.51, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxyoctane;sulfuric acid;zinc is sourced from PubChem (CID 175286221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).