C18H16O — CID 175286518
1,6,7,8-tetrahydrochrysen-2-ol (PubChem CID 175286518) has the molecular formula C18H16O and a molecular weight of 248.32 g/mol. Its IUPAC name is 1,6,7,8-tetrahydrochrysen-2-ol.
| Compound Name | 1,6,7,8-tetrahydrochrysen-2-ol |
|---|---|
| PubChem CID | 175286518 |
| Molecular Formula | C18H16O |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1,6,7,8-tetrahydrochrysen-2-ol |
| SMILES | OC1=CC=c2c(ccc3c2=CCC2=C3C=CCC2)C1 |
| InChI | InChI=1S/C18H16O/c19-14-7-10-16-13(11-14)6-9-17-15-4-2-1-3-12(15)5-8-18(16)17/h2,4,6-10,19H,1,3,5,11H2 |
| InChIKey | MUJYUZPVFDYBIG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |