C28H55N2+ — CID 175286697
1,1,2,4,5-pentapentylimidazol-1-ium (PubChem CID 175286697) has the molecular formula C28H55N2+ and a molecular weight of 419.76 g/mol. Its IUPAC name is 1,1,2,4,5-pentapentylimidazol-1-ium.
| Compound Name | 1,1,2,4,5-pentapentylimidazol-1-ium |
|---|---|
| PubChem CID | 175286697 |
| Molecular Formula | C28H55N2+ |
| Molecular Weight | 419.76 g/mol |
| Exact Mass | 419.44 |
| IUPAC Name | 1,1,2,4,5-pentapentylimidazol-1-ium |
| SMILES | CCCCCC1=NC(CCCCC)=C(CCCCC)[N+]1(CCCCC)CCCCC |
| InChI | InChI=1S/C28H55N2/c1-6-11-16-21-26-27(22-17-12-7-2)30(24-19-14-9-4,25-20-15-10-5)28(29-26)23-18-13-8-3/h6-25H2,1-5H3/q+1 |
| InChIKey | NCUYSBJOFWCBBY-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.76 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|