C17H34ClNO3 — CID 175286908
2-[1-(decylamino)ethoxy]ethyl prop-2-enoate;hydrochloride (PubChem CID 175286908) has the molecular formula C17H34ClNO3 and a molecular weight of 335.92 g/mol. Its IUPAC name is 2-[1-(decylamino)ethoxy]ethyl prop-2-enoate;hydrochloride.
| Compound Name | 2-[1-(decylamino)ethoxy]ethyl prop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 175286908 |
| Molecular Formula | C17H34ClNO3 |
| Molecular Weight | 335.92 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 2-[1-(decylamino)ethoxy]ethyl prop-2-enoate;hydrochloride |
| SMILES | C=CC(=O)OCCOC(C)NCCCCCCCCCC.Cl |
| InChI | InChI=1S/C17H33NO3.ClH/c1-4-6-7-8-9-10-11-12-13-18-16(3)20-14-15-21-17(19)5-2;/h5,16,18H,2,4,6-15H2,1,3H3;1H |
| InChIKey | VZAXDNLUUIGGBA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.92 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|