C17H19NO4 — CID 175286928
2-hydroxy-3-(4-morpholin-4-ylnaphthalen-1-yl)propanoic acid (PubChem CID 175286928) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-hydroxy-3-(4-morpholin-4-ylnaphthalen-1-yl)propanoic acid.
| Compound Name | 2-hydroxy-3-(4-morpholin-4-ylnaphthalen-1-yl)propanoic acid |
|---|---|
| PubChem CID | 175286928 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-hydroxy-3-(4-morpholin-4-ylnaphthalen-1-yl)propanoic acid |
| SMILES | O=C(O)C(O)Cc1ccc(N2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C17H19NO4/c19-16(17(20)21)11-12-5-6-15(18-7-9-22-10-8-18)14-4-2-1-3-13(12)14/h1-6,16,19H,7-11H2,(H,20,21) |
| InChIKey | YEZFLYNPQPREJL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |