C17H24INO3 — CID 175287155
[(1S,2S)-2-[1-(2-iodophenyl)-1-methoxypropyl]cyclohexyl] carbamate (PubChem CID 175287155) has the molecular formula C17H24INO3 and a molecular weight of 417.29 g/mol. Its IUPAC name is [(1S,2S)-2-[1-(2-iodophenyl)-1-methoxypropyl]cyclohexyl] carbamate.
| Compound Name | [(1S,2S)-2-[1-(2-iodophenyl)-1-methoxypropyl]cyclohexyl] carbamate |
|---|---|
| PubChem CID | 175287155 |
| Molecular Formula | C17H24INO3 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | [(1S,2S)-2-[1-(2-iodophenyl)-1-methoxypropyl]cyclohexyl] carbamate |
| SMILES | CCC(OC)(c1ccccc1I)[C@H]1CCCC[C@@H]1OC(N)=O |
| InChI | InChI=1S/C17H24INO3/c1-3-17(21-2,12-8-4-6-10-14(12)18)13-9-5-7-11-15(13)22-16(19)20/h4,6,8,10,13,15H,3,5,7,9,11H2,1-2H3,(H2,19,20)/t13-,15-,17?/m0/s1 |
| InChIKey | XDHLAKQTKZMTBX-JENVPCQVSA-N |
| XLogP | 4.20 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|