C16H34O9 — CID 175287785
2-[2-(dihydroxymethyl)-1,1-dihydroxyheptan-2-yl]oxy-2-pentylpropane-1,1,3,3-tetrol (PubChem CID 175287785) has the molecular formula C16H34O9 and a molecular weight of 370.44 g/mol. Its IUPAC name is 2-[2-(dihydroxymethyl)-1,1-dihydroxyheptan-2-yl]oxy-2-pentylpropane-1,1,3,3-tetrol.
| Compound Name | 2-[2-(dihydroxymethyl)-1,1-dihydroxyheptan-2-yl]oxy-2-pentylpropane-1,1,3,3-tetrol |
|---|---|
| PubChem CID | 175287785 |
| Molecular Formula | C16H34O9 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 2-[2-(dihydroxymethyl)-1,1-dihydroxyheptan-2-yl]oxy-2-pentylpropane-1,1,3,3-tetrol |
| SMILES | CCCCCC(OC(CCCCC)(C(O)O)C(O)O)(C(O)O)C(O)O |
| InChI | InChI=1S/C16H34O9/c1-3-5-7-9-15(11(17)18,12(19)20)25-16(13(21)22,14(23)24)10-8-6-4-2/h11-14,17-24H,3-10H2,1-2H3 |
| InChIKey | QYBSXRGQJJAWQD-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|